About [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone
[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone (PubChem CID 16725568) has the molecular formula C27H27NO2
and a molecular weight of 397.52 g/mol. Its IUPAC name is [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone |
| PubChem CID | 16725568 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone |
| SMILES | Cc1cccc(C2C(C(=O)c3ccccc3)CNCC2C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C27H27NO2/c1-18-10-9-15-22(19(18)2)25-23(26(29)20-11-5-3-6-12-20)16-28-17-24(25)27(30)21-13-7-4-8-14-21/h3-15,23-25,28H,16-17H2,1-2H3 |
| InChIKey | AYXXDQKHBIGSPX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone?
The IUPAC name of [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone (CID 16725568) is [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone.
What is the SMILES notation for [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone?
The canonical SMILES for [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone is Cc1cccc(C2C(C(=O)c3ccccc3)CNCC2C(=O)c2ccccc2)c1C.
What is the InChIKey of [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone?
The InChIKey is AYXXDQKHBIGSPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27NO2/c1-18-10-9-15-22(19(18)2)25-23(26(29)20-11-5-3-6-12-20)16-28-17-24(25)27(30)21-13-7-4-8-14-21/h3-15,23-25,28H,16-17H2,1-2H3.
What are the key properties of [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone?
[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone has a molecular weight of 397.52 g/mol, XLogP of 4.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone is sourced from PubChem (CID 16725568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).