C27H27NO2 — CID 16725568
[5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone (PubChem CID 16725568) has the molecular formula C27H27NO2 and a molecular weight of 397.52 g/mol. Its IUPAC name is [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone.
| Compound Name | [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 16725568 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [5-benzoyl-4-(2,3-dimethylphenyl)piperidin-3-yl]-phenylmethanone |
| SMILES | Cc1cccc(C2C(C(=O)c3ccccc3)CNCC2C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C27H27NO2/c1-18-10-9-15-22(19(18)2)25-23(26(29)20-11-5-3-6-12-20)16-28-17-24(25)27(30)21-13-7-4-8-14-21/h3-15,23-25,28H,16-17H2,1-2H3 |
| InChIKey | AYXXDQKHBIGSPX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |