C38H57N5O5S — CID 59991725
N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-5-[[1-hydroxy-2-oxo-2-(1-phenylethylamino)ethyl]amino]hexyl]decanamide (PubChem CID 59991725) has the molecular formula C38H57N5O5S and a molecular weight of 695.97 g/mol. Its IUPAC name is N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-5-[[1-hydroxy-2-oxo-2-(1-phenylethylamino)ethyl]amino]hexyl]decanamide.
| Compound Name | N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-5-[[1-hydroxy-2-oxo-2-(1-phenylethylamino)ethyl]amino]hexyl]decanamide |
|---|---|
| PubChem CID | 59991725 |
| Molecular Formula | C38H57N5O5S |
| Molecular Weight | 695.97 g/mol |
| Exact Mass | 695.41 |
| IUPAC Name | N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-5-[[1-hydroxy-2-oxo-2-(1-phenylethylamino)ethyl]amino]hexyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCCCCC(CNS(=O)(=O)c1cccc2c(N(C)C)cccc12)NC(O)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C38H57N5O5S/c1-5-6-7-8-9-10-14-26-36(44)39-27-16-15-21-31(42-38(46)37(45)41-29(2)30-19-12-11-13-20-30)28-40-49(47,48)35-25-18-22-32-33(35)23-17-24-34(32)43(3)4/h11-13,17-20,22-25,29,31,38,40,42,46H,5-10,14-16,21,26-28H2,1-4H3,(H,39,44)(H,41,45) |
| InChIKey | DARHCQPZXZAMGV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.97 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|