C40H52N8O2S — CID 25039260
N-[6-[[4-(butylamino)-6-(3,3-diphenylpropylamino)-1,3,5-triazin-2-yl]amino]hexyl]-5-(dimethylamino)naphthalene-1-sulfonamide (PubChem CID 25039260) has the molecular formula C40H52N8O2S and a molecular weight of 708.98 g/mol. Its IUPAC name is N-[6-[[4-(butylamino)-6-(3,3-diphenylpropylamino)-1,3,5-triazin-2-yl]amino]hexyl]-5-(dimethylamino)naphthalene-1-sulfonamide.
| Compound Name | N-[6-[[4-(butylamino)-6-(3,3-diphenylpropylamino)-1,3,5-triazin-2-yl]amino]hexyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 25039260 |
| Molecular Formula | C40H52N8O2S |
| Molecular Weight | 708.98 g/mol |
| Exact Mass | 708.39 |
| IUPAC Name | N-[6-[[4-(butylamino)-6-(3,3-diphenylpropylamino)-1,3,5-triazin-2-yl]amino]hexyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
| SMILES | CCCCNc1nc(NCCCCCCNS(=O)(=O)c2cccc3c(N(C)C)cccc23)nc(NCCC(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C40H52N8O2S/c1-4-5-27-41-38-45-39(47-40(46-38)43-30-26-33(31-18-10-8-11-19-31)32-20-12-9-13-21-32)42-28-14-6-7-15-29-44-51(49,50)37-25-17-22-34-35(37)23-16-24-36(34)48(2)3/h8-13,16-25,33,44H,4-7,14-15,26-30H2,1-3H3,(H3,41,42,43,45,46,47) |
| InChIKey | QELUWGOIYXZIOC-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.98 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|