C35H48N8O2S — CID 25042043
N-[6-[[4-(benzylamino)-6-[(2-methylcyclohexyl)amino]-1,3,5-triazin-2-yl]amino]hexyl]-5-(dimethylamino)naphthalene-1-sulfonamide (PubChem CID 25042043) has the molecular formula C35H48N8O2S and a molecular weight of 644.89 g/mol. Its IUPAC name is N-[6-[[4-(benzylamino)-6-[(2-methylcyclohexyl)amino]-1,3,5-triazin-2-yl]amino]hexyl]-5-(dimethylamino)naphthalene-1-sulfonamide.
| Compound Name | N-[6-[[4-(benzylamino)-6-[(2-methylcyclohexyl)amino]-1,3,5-triazin-2-yl]amino]hexyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 25042043 |
| Molecular Formula | C35H48N8O2S |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.36 |
| IUPAC Name | N-[6-[[4-(benzylamino)-6-[(2-methylcyclohexyl)amino]-1,3,5-triazin-2-yl]amino]hexyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
| SMILES | CC1CCCCC1Nc1nc(NCCCCCCNS(=O)(=O)c2cccc3c(N(C)C)cccc23)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C35H48N8O2S/c1-26-15-9-10-20-30(26)39-35-41-33(40-34(42-35)37-25-27-16-7-6-8-17-27)36-23-11-4-5-12-24-38-46(44,45)32-22-14-18-28-29(32)19-13-21-31(28)43(2)3/h6-8,13-14,16-19,21-22,26,30,38H,4-5,9-12,15,20,23-25H2,1-3H3,(H3,36,37,39,40,41,42) |
| InChIKey | DCZRJFIZMVILDX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|