C24H29Cl2N3O3S — CID 164617854
5-[(1-acetylpiperidin-4-yl)amino]-N-benzylnaphthalene-1-sulfonamide;dihydrochloride (PubChem CID 164617854) has the molecular formula C24H29Cl2N3O3S and a molecular weight of 510.49 g/mol. Its IUPAC name is 5-[(1-acetylpiperidin-4-yl)amino]-N-benzylnaphthalene-1-sulfonamide;dihydrochloride.
| Compound Name | 5-[(1-acetylpiperidin-4-yl)amino]-N-benzylnaphthalene-1-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 164617854 |
| Molecular Formula | C24H29Cl2N3O3S |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 5-[(1-acetylpiperidin-4-yl)amino]-N-benzylnaphthalene-1-sulfonamide;dihydrochloride |
| SMILES | CC(=O)N1CCC(Nc2cccc3c(S(=O)(=O)NCc4ccccc4)cccc23)CC1.Cl.Cl |
| InChI | InChI=1S/C24H27N3O3S.2ClH/c1-18(28)27-15-13-20(14-16-27)26-23-11-5-10-22-21(23)9-6-12-24(22)31(29,30)25-17-19-7-3-2-4-8-19;;/h2-12,20,25-26H,13-17H2,1H3;2*1H |
| InChIKey | IKKCAJMPTVASKB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |