C21H26N2O4S — CID 69029468
[4-[[(4-phenylphenyl)sulfonylamino]methyl]cyclohexyl]methylcarbamic acid (PubChem CID 69029468) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is [4-[[(4-phenylphenyl)sulfonylamino]methyl]cyclohexyl]methylcarbamic acid.
| Compound Name | [4-[[(4-phenylphenyl)sulfonylamino]methyl]cyclohexyl]methylcarbamic acid |
|---|---|
| PubChem CID | 69029468 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [4-[[(4-phenylphenyl)sulfonylamino]methyl]cyclohexyl]methylcarbamic acid |
| SMILES | O=C(O)NCC1CCC(CNS(=O)(=O)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C21H26N2O4S/c24-21(25)22-14-16-6-8-17(9-7-16)15-23-28(26,27)20-12-10-19(11-13-20)18-4-2-1-3-5-18/h1-5,10-13,16-17,22-23H,6-9,14-15H2,(H,24,25) |
| InChIKey | GGQQZSUDWPANFI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |