C11H19N3O4S2 — CID 120708670
2-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]benzene-1,2-disulfonamide (PubChem CID 120708670) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]benzene-1,2-disulfonamide.
| Compound Name | 2-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]benzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 120708670 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-N,2-N-dimethyl-1-N-[2-(methylamino)ethyl]benzene-1,2-disulfonamide |
| SMILES | CNCCNS(=O)(=O)c1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C11H19N3O4S2/c1-12-8-9-13-19(15,16)10-6-4-5-7-11(10)20(17,18)14(2)3/h4-7,12-13H,8-9H2,1-3H3 |
| InChIKey | DHFZQUSEYXIEHD-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|