C16H21N3O4S2 — CID 120715586
1-N-[2-(4-aminophenyl)ethyl]-2-N,2-N-dimethylbenzene-1,2-disulfonamide (PubChem CID 120715586) has the molecular formula C16H21N3O4S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-N-[2-(4-aminophenyl)ethyl]-2-N,2-N-dimethylbenzene-1,2-disulfonamide.
| Compound Name | 1-N-[2-(4-aminophenyl)ethyl]-2-N,2-N-dimethylbenzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 120715586 |
| Molecular Formula | C16H21N3O4S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-N-[2-(4-aminophenyl)ethyl]-2-N,2-N-dimethylbenzene-1,2-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1S(=O)(=O)NCCc1ccc(N)cc1 |
| InChI | InChI=1S/C16H21N3O4S2/c1-19(2)25(22,23)16-6-4-3-5-15(16)24(20,21)18-12-11-13-7-9-14(17)10-8-13/h3-10,18H,11-12,17H2,1-2H3 |
| InChIKey | XVRAYXDHLLPZOD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|