C13H21N3O5S2 — CID 19966722
1-butyl-3-[2-(dimethylsulfamoyl)phenyl]sulfonylurea (PubChem CID 19966722) has the molecular formula C13H21N3O5S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-butyl-3-[2-(dimethylsulfamoyl)phenyl]sulfonylurea.
| Compound Name | 1-butyl-3-[2-(dimethylsulfamoyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 19966722 |
| Molecular Formula | C13H21N3O5S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 1-butyl-3-[2-(dimethylsulfamoyl)phenyl]sulfonylurea |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H21N3O5S2/c1-4-5-10-14-13(17)15-22(18,19)11-8-6-7-9-12(11)23(20,21)16(2)3/h6-9H,4-5,10H2,1-3H3,(H2,14,15,17) |
| InChIKey | RRLULQHWLZIOOQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|