C10H16N2O5S3 — CID 13322004
1-butyl-3-(2-methylsulfonylthiophen-3-yl)sulfonylurea (PubChem CID 13322004) has the molecular formula C10H16N2O5S3 and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-butyl-3-(2-methylsulfonylthiophen-3-yl)sulfonylurea.
| Compound Name | 1-butyl-3-(2-methylsulfonylthiophen-3-yl)sulfonylurea |
|---|---|
| PubChem CID | 13322004 |
| Molecular Formula | C10H16N2O5S3 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 1-butyl-3-(2-methylsulfonylthiophen-3-yl)sulfonylurea |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccsc1S(C)(=O)=O |
| InChI | InChI=1S/C10H16N2O5S3/c1-3-4-6-11-10(13)12-20(16,17)8-5-7-18-9(8)19(2,14)15/h5,7H,3-4,6H2,1-2H3,(H2,11,12,13) |
| InChIKey | VSIXCXSUPMLANY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|