C12H18N2O6S — CID 13090075
methyl 4-(butylcarbamoylsulfamoyl)-5-methylfuran-2-carboxylate (PubChem CID 13090075) has the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. Its IUPAC name is methyl 4-(butylcarbamoylsulfamoyl)-5-methylfuran-2-carboxylate.
| Compound Name | methyl 4-(butylcarbamoylsulfamoyl)-5-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 13090075 |
| Molecular Formula | C12H18N2O6S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | methyl 4-(butylcarbamoylsulfamoyl)-5-methylfuran-2-carboxylate |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1cc(C(=O)OC)oc1C |
| InChI | InChI=1S/C12H18N2O6S/c1-4-5-6-13-12(16)14-21(17,18)10-7-9(11(15)19-3)20-8(10)2/h7H,4-6H2,1-3H3,(H2,13,14,16) |
| InChIKey | YRXHFYBUSDMAMP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|