C17H22N2O5S — CID 3069822
1-butyl-3-(4,5,7-trimethyl-2-oxochromen-8-yl)sulfonylurea (PubChem CID 3069822) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-butyl-3-(4,5,7-trimethyl-2-oxochromen-8-yl)sulfonylurea.
| Compound Name | 1-butyl-3-(4,5,7-trimethyl-2-oxochromen-8-yl)sulfonylurea |
|---|---|
| PubChem CID | 3069822 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-butyl-3-(4,5,7-trimethyl-2-oxochromen-8-yl)sulfonylurea |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1c(C)cc(C)c2c(C)cc(=O)oc12 |
| InChI | InChI=1S/C17H22N2O5S/c1-5-6-7-18-17(21)19-25(22,23)16-12(4)8-10(2)14-11(3)9-13(20)24-15(14)16/h8-9H,5-7H2,1-4H3,(H2,18,19,21) |
| InChIKey | DKBTUMCACVBKHI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|