C11H17N2O6PS — CID 67821982
[3-(butylcarbamoylsulfamoyl)phenyl]phosphonic acid (PubChem CID 67821982) has the molecular formula C11H17N2O6PS and a molecular weight of 336.31 g/mol. Its IUPAC name is [3-(butylcarbamoylsulfamoyl)phenyl]phosphonic acid.
| Compound Name | [3-(butylcarbamoylsulfamoyl)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 67821982 |
| Molecular Formula | C11H17N2O6PS |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [3-(butylcarbamoylsulfamoyl)phenyl]phosphonic acid |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1cccc(P(=O)(O)O)c1 |
| InChI | InChI=1S/C11H17N2O6PS/c1-2-3-7-12-11(14)13-21(18,19)10-6-4-5-9(8-10)20(15,16)17/h4-6,8H,2-3,7H2,1H3,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | XGOLLNTUEJDMAY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|