C9H12N4O2S2 — CID 62657997
N-[2-(methylamino)ethyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 62657997) has the molecular formula C9H12N4O2S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[2-(methylamino)ethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 62657997 |
| Molecular Formula | C9H12N4O2S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N-[2-(methylamino)ethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CNCCNS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C9H12N4O2S2/c1-10-5-6-11-17(14,15)8-4-2-3-7-9(8)13-16-12-7/h2-4,10-11H,5-6H2,1H3 |
| InChIKey | MWFYHSXRCXYBBB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|