C9H11N5O3S2 — CID 76953208
3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N'-hydroxypropanimidamide (PubChem CID 76953208) has the molecular formula C9H11N5O3S2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N'-hydroxypropanimidamide.
| Compound Name | 3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76953208 |
| Molecular Formula | C9H11N5O3S2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N'-hydroxypropanimidamide |
| SMILES | NC(CCNS(=O)(=O)c1cccc2nsnc12)=NO |
| InChI | InChI=1S/C9H11N5O3S2/c10-8(12-15)4-5-11-19(16,17)7-3-1-2-6-9(7)14-18-13-6/h1-3,11,15H,4-5H2,(H2,10,12) |
| InChIKey | JVOYTELBZWGWCD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|