C14H13N5O3S2 — CID 42534829
N-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)ethyl]pyridine-2-carboxamide (PubChem CID 42534829) has the molecular formula C14H13N5O3S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)ethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 42534829 |
| Molecular Formula | C14H13N5O3S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)ethyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cccc2nsnc12)c1ccccn1 |
| InChI | InChI=1S/C14H13N5O3S2/c20-14(11-4-1-2-7-15-11)16-8-9-17-24(21,22)12-6-3-5-10-13(12)19-23-18-10/h1-7,17H,8-9H2,(H,16,20) |
| InChIKey | AZIRDAWOOSQMGJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|