C16H16N4O3S2 — CID 55905079
4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-ethylbenzamide (PubChem CID 55905079) has the molecular formula C16H16N4O3S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-ethylbenzamide.
| Compound Name | 4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 55905079 |
| Molecular Formula | C16H16N4O3S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 4-[(2,1,3-benzothiadiazol-4-ylsulfonylamino)methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(CNS(=O)(=O)c2cccc3nsnc23)cc1 |
| InChI | InChI=1S/C16H16N4O3S2/c1-2-17-16(21)12-8-6-11(7-9-12)10-18-25(22,23)14-5-3-4-13-15(14)20-24-19-13/h3-9,18H,2,10H2,1H3,(H,17,21) |
| InChIKey | KHCOXUFDCSWJHS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |