C16H16Br2N2O3S — CID 55906367
4-[[(2,4-dibromophenyl)sulfonylamino]methyl]-N-ethylbenzamide (PubChem CID 55906367) has the molecular formula C16H16Br2N2O3S and a molecular weight of 476.19 g/mol. Its IUPAC name is 4-[[(2,4-dibromophenyl)sulfonylamino]methyl]-N-ethylbenzamide.
| Compound Name | 4-[[(2,4-dibromophenyl)sulfonylamino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 55906367 |
| Molecular Formula | C16H16Br2N2O3S |
| Molecular Weight | 476.19 g/mol |
| Exact Mass | 473.92 |
| IUPAC Name | 4-[[(2,4-dibromophenyl)sulfonylamino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(CNS(=O)(=O)c2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C16H16Br2N2O3S/c1-2-19-16(21)12-5-3-11(4-6-12)10-20-24(22,23)15-8-7-13(17)9-14(15)18/h3-9,20H,2,10H2,1H3,(H,19,21) |
| InChIKey | WMPKMMIJXPJGAH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.19 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |