C17H16N4O4S2 — CID 3239184
N-(3-acetylphenyl)-3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanamide (PubChem CID 3239184) has the molecular formula C17H16N4O4S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-(3-acetylphenyl)-3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanamide.
| Compound Name | N-(3-acetylphenyl)-3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 3239184 |
| Molecular Formula | C17H16N4O4S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | N-(3-acetylphenyl)-3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)CCNS(=O)(=O)c2cccc3nsnc23)c1 |
| InChI | InChI=1S/C17H16N4O4S2/c1-11(22)12-4-2-5-13(10-12)19-16(23)8-9-18-27(24,25)15-7-3-6-14-17(15)21-26-20-14/h2-7,10,18H,8-9H2,1H3,(H,19,23) |
| InChIKey | DABQRKBJBUWZKF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |