C14H24ClN3O4S2 — CID 120707249
N-[3-(methylamino)propyl]-2-pyrrolidin-1-ylsulfonylbenzenesulfonamide;hydrochloride (PubChem CID 120707249) has the molecular formula C14H24ClN3O4S2 and a molecular weight of 397.95 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-2-pyrrolidin-1-ylsulfonylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-2-pyrrolidin-1-ylsulfonylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120707249 |
| Molecular Formula | C14H24ClN3O4S2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[3-(methylamino)propyl]-2-pyrrolidin-1-ylsulfonylbenzenesulfonamide;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)c1ccccc1S(=O)(=O)N1CCCC1.Cl |
| InChI | InChI=1S/C14H23N3O4S2.ClH/c1-15-9-6-10-16-22(18,19)13-7-2-3-8-14(13)23(20,21)17-11-4-5-12-17;/h2-3,7-8,15-16H,4-6,9-12H2,1H3;1H |
| InChIKey | FLDKVRCTBINWBE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|