C13H15N3 — CID 155173890
N-[(1Z)-buta-1,3-dienyl]-N,1-dimethylbenzimidazol-2-amine (PubChem CID 155173890) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-N,1-dimethylbenzimidazol-2-amine.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-N,1-dimethylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 155173890 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-N,1-dimethylbenzimidazol-2-amine |
| SMILES | C=C/C=C\N(C)c1nc2ccccc2n1C |
| InChI | InChI=1S/C13H15N3/c1-4-5-10-15(2)13-14-11-8-6-7-9-12(11)16(13)3/h4-10H,1H2,2-3H3/b10-5- |
| InChIKey | RPOWZHBFOAIGNI-YHYXMXQVSA-N |
| XLogP | 2.71 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|