C14H16N4 — CID 115144025
N,1-dimethyl-N-(1H-pyrrol-3-ylmethyl)benzimidazol-2-amine (PubChem CID 115144025) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is N,1-dimethyl-N-(1H-pyrrol-3-ylmethyl)benzimidazol-2-amine.
| Compound Name | N,1-dimethyl-N-(1H-pyrrol-3-ylmethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115144025 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N,1-dimethyl-N-(1H-pyrrol-3-ylmethyl)benzimidazol-2-amine |
| SMILES | CN(Cc1cc[nH]c1)c1nc2ccccc2n1C |
| InChI | InChI=1S/C14H16N4/c1-17(10-11-7-8-15-9-11)14-16-12-5-3-4-6-13(12)18(14)2/h3-9,15H,10H2,1-2H3 |
| InChIKey | FLSDHLDOKYTMSL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |