C13H19N3 — CID 71723450
N-butyl-N,1-dimethylbenzimidazol-2-amine (PubChem CID 71723450) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N-butyl-N,1-dimethylbenzimidazol-2-amine.
| Compound Name | N-butyl-N,1-dimethylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 71723450 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-butyl-N,1-dimethylbenzimidazol-2-amine |
| SMILES | CCCCN(C)c1nc2ccccc2n1C |
| InChI | InChI=1S/C13H19N3/c1-4-5-10-15(2)13-14-11-8-6-7-9-12(11)16(13)3/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | MQDHWQWAQCVOTC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |