C16H23N3 — CID 115144037
N-(cyclohexylmethyl)-N,1-dimethylbenzimidazol-2-amine (PubChem CID 115144037) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N,1-dimethylbenzimidazol-2-amine.
| Compound Name | N-(cyclohexylmethyl)-N,1-dimethylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 115144037 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N-(cyclohexylmethyl)-N,1-dimethylbenzimidazol-2-amine |
| SMILES | CN(CC1CCCCC1)c1nc2ccccc2n1C |
| InChI | InChI=1S/C16H23N3/c1-18(12-13-8-4-3-5-9-13)16-17-14-10-6-7-11-15(14)19(16)2/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3 |
| InChIKey | APFDMXUGYGWAJY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |