C14H21N3 — CID 43192433
N-[1-(1-methylbenzimidazol-2-yl)ethyl]butan-1-amine (PubChem CID 43192433) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-[1-(1-methylbenzimidazol-2-yl)ethyl]butan-1-amine.
| Compound Name | N-[1-(1-methylbenzimidazol-2-yl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 43192433 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N-[1-(1-methylbenzimidazol-2-yl)ethyl]butan-1-amine |
| SMILES | CCCCNC(C)c1nc2ccccc2n1C |
| InChI | InChI=1S/C14H21N3/c1-4-5-10-15-11(2)14-16-12-8-6-7-9-13(12)17(14)3/h6-9,11,15H,4-5,10H2,1-3H3 |
| InChIKey | RYBZELRTZBNXMK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|