C17H27N3S — CID 103911042
2-ethyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]-2-methylsulfanylbutan-1-amine (PubChem CID 103911042) has the molecular formula C17H27N3S and a molecular weight of 305.49 g/mol. Its IUPAC name is 2-ethyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]-2-methylsulfanylbutan-1-amine.
| Compound Name | 2-ethyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]-2-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 103911042 |
| Molecular Formula | C17H27N3S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-ethyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]-2-methylsulfanylbutan-1-amine |
| SMILES | CCC(CC)(CNC(C)c1nc2ccccc2n1C)SC |
| InChI | InChI=1S/C17H27N3S/c1-6-17(7-2,21-5)12-18-13(3)16-19-14-10-8-9-11-15(14)20(16)4/h8-11,13,18H,6-7,12H2,1-5H3 |
| InChIKey | NJWSZCKNGRPVRH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |