C17H28N4 — CID 43194800
N',N'-diethyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]propane-1,3-diamine (PubChem CID 43194800) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is N',N'-diethyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 43194800 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | N',N'-diethyl-N-[1-(1-methylbenzimidazol-2-yl)ethyl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNC(C)c1nc2ccccc2n1C |
| InChI | InChI=1S/C17H28N4/c1-5-21(6-2)13-9-12-18-14(3)17-19-15-10-7-8-11-16(15)20(17)4/h7-8,10-11,14,18H,5-6,9,12-13H2,1-4H3 |
| InChIKey | GPZQIRAWXXWUAE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|