C17H25F3 — CID 143612069
(3Z,5E)-6,7-difluorohepta-1,3,5-triene;ethane;fluorobenzene (PubChem CID 143612069) has the molecular formula C17H25F3 and a molecular weight of 286.38 g/mol. Its IUPAC name is (3Z,5E)-6,7-difluorohepta-1,3,5-triene;ethane;fluorobenzene.
| Compound Name | (3Z,5E)-6,7-difluorohepta-1,3,5-triene;ethane;fluorobenzene |
|---|---|
| PubChem CID | 143612069 |
| Molecular Formula | C17H25F3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (3Z,5E)-6,7-difluorohepta-1,3,5-triene;ethane;fluorobenzene |
| SMILES | C=C/C=C\C=C(\F)CF.CC.CC.Fc1ccccc1 |
| InChI | InChI=1S/C7H8F2.C6H5F.2C2H6/c1-2-3-4-5-7(9)6-8;7-6-4-2-1-3-5-6;2*1-2/h2-5H,1,6H2;1-5H;2*1-2H3/b4-3-,7-5+;;; |
| InChIKey | GOFKZPXQABXEGL-KITKHWLNSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|