About ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline
ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline (PubChem CID 145203867) has the molecular formula C21H26FN
and a molecular weight of 311.44 g/mol. Its IUPAC name is ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline.
Molecular Properties
| Compound Name | ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline |
| PubChem CID | 145203867 |
| Molecular Formula | C21H26FN |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline |
| SMILES | C/C=C\C=C(/CC)N(c1ccccc1)c1cccc(F)c1.CC |
| InChI | InChI=1S/C19H20FN.C2H6/c1-3-5-11-17(4-2)21(18-12-7-6-8-13-18)19-14-9-10-16(20)15-19;1-2/h3,5-15H,4H2,1-2H3;1-2H3/b5-3-,17-11+; |
| InChIKey | ARIKRQTZKUJAEC-MQLRSVAYSA-N |
| XLogP | 6.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline?
The IUPAC name of ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline (CID 145203867) is ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline.
What is the SMILES notation for ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline?
The canonical SMILES for ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline is C/C=C\C=C(/CC)N(c1ccccc1)c1cccc(F)c1.CC.
What is the InChIKey of ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline?
The InChIKey is ARIKRQTZKUJAEC-MQLRSVAYSA-N. The full InChI is InChI=1S/C19H20FN.C2H6/c1-3-5-11-17(4-2)21(18-12-7-6-8-13-18)19-14-9-10-16(20)15-19;1-2/h3,5-15H,4H2,1-2H3;1-2H3/b5-3-,17-11+;.
What are the key properties of ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline?
ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline has a molecular weight of 311.44 g/mol, XLogP of 6.86, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline is sourced from PubChem (CID 145203867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).