C21H26FN — CID 145203867
ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline (PubChem CID 145203867) has the molecular formula C21H26FN and a molecular weight of 311.44 g/mol. Its IUPAC name is ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline.
| Compound Name | ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 145203867 |
| Molecular Formula | C21H26FN |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | ethane;3-fluoro-N-[(3E,5Z)-hepta-3,5-dien-3-yl]-N-phenylaniline |
| SMILES | C/C=C\C=C(/CC)N(c1ccccc1)c1cccc(F)c1.CC |
| InChI | InChI=1S/C19H20FN.C2H6/c1-3-5-11-17(4-2)21(18-12-7-6-8-13-18)19-14-9-10-16(20)15-19;1-2/h3,5-15H,4H2,1-2H3;1-2H3/b5-3-,17-11+; |
| InChIKey | ARIKRQTZKUJAEC-MQLRSVAYSA-N |
| XLogP | 6.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|