C16H24N2 — CID 23267396
(1Z,3Z)-1-N',1-N'-diethyl-1-N-methyl-1-N-phenylpenta-1,3-diene-1,1-diamine (PubChem CID 23267396) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (1Z,3Z)-1-N',1-N'-diethyl-1-N-methyl-1-N-phenylpenta-1,3-diene-1,1-diamine.
| Compound Name | (1Z,3Z)-1-N',1-N'-diethyl-1-N-methyl-1-N-phenylpenta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 23267396 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (1Z,3Z)-1-N',1-N'-diethyl-1-N-methyl-1-N-phenylpenta-1,3-diene-1,1-diamine |
| SMILES | C/C=C\C=C(\N(CC)CC)N(C)c1ccccc1 |
| InChI | InChI=1S/C16H24N2/c1-5-8-14-16(18(6-2)7-3)17(4)15-12-10-9-11-13-15/h5,8-14H,6-7H2,1-4H3/b8-5-,16-14+ |
| InChIKey | NDNRERBCWXTZFM-XBHCWAOGSA-N |
| XLogP | 3.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|