C18H27NO — CID 142896900
(3E,5Z)-1-[ethyl(2-phenylethyl)amino]-2-methylhepta-3,5-dien-3-ol (PubChem CID 142896900) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (3E,5Z)-1-[ethyl(2-phenylethyl)amino]-2-methylhepta-3,5-dien-3-ol.
| Compound Name | (3E,5Z)-1-[ethyl(2-phenylethyl)amino]-2-methylhepta-3,5-dien-3-ol |
|---|---|
| PubChem CID | 142896900 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (3E,5Z)-1-[ethyl(2-phenylethyl)amino]-2-methylhepta-3,5-dien-3-ol |
| SMILES | C/C=C\C=C(\O)C(C)CN(CC)CCc1ccccc1 |
| InChI | InChI=1S/C18H27NO/c1-4-6-12-18(20)16(3)15-19(5-2)14-13-17-10-8-7-9-11-17/h4,6-12,16,20H,5,13-15H2,1-3H3/b6-4-,18-12+ |
| InChIKey | CALUWXWGQGNXEX-WZMVWGNZSA-N |
| XLogP | 4.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|