C22H29N — CID 159854693
2-(4-ethenylphenyl)-N,N-diethylethanamine;styrene (PubChem CID 159854693) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)-N,N-diethylethanamine;styrene.
| Compound Name | 2-(4-ethenylphenyl)-N,N-diethylethanamine;styrene |
|---|---|
| PubChem CID | 159854693 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-(4-ethenylphenyl)-N,N-diethylethanamine;styrene |
| SMILES | C=Cc1ccc(CCN(CC)CC)cc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C14H21N.C8H8/c1-4-13-7-9-14(10-8-13)11-12-15(5-2)6-3;1-2-8-6-4-3-5-7-8/h4,7-10H,1,5-6,11-12H2,2-3H3;2-7H,1H2 |
| InChIKey | NQJKYBQDWDWOBI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |