C17H23N — CID 144569144
N-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-methyl-N-[(E)-prop-1-enyl]aniline (PubChem CID 144569144) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is N-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-methyl-N-[(E)-prop-1-enyl]aniline.
| Compound Name | N-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-methyl-N-[(E)-prop-1-enyl]aniline |
|---|---|
| PubChem CID | 144569144 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-methyl-N-[(E)-prop-1-enyl]aniline |
| SMILES | C/C=C\C=C(/CC)N(/C=C/C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23N/c1-5-8-9-16(7-3)18(14-6-2)17-12-10-15(4)11-13-17/h5-6,8-14H,7H2,1-4H3/b8-5-,14-6+,16-9+ |
| InChIKey | CIIBKDHVLJWENT-VDHVAUKPSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|