C13H16N2O — CID 131636948
(2E,4E)-N-(4-methylphenyl)hexa-2,4-dienehydrazide (PubChem CID 131636948) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (2E,4E)-N-(4-methylphenyl)hexa-2,4-dienehydrazide.
| Compound Name | (2E,4E)-N-(4-methylphenyl)hexa-2,4-dienehydrazide |
|---|---|
| PubChem CID | 131636948 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (2E,4E)-N-(4-methylphenyl)hexa-2,4-dienehydrazide |
| SMILES | C/C=C/C=C/C(=O)N(N)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H16N2O/c1-3-4-5-6-13(16)15(14)12-9-7-11(2)8-10-12/h3-10H,14H2,1-2H3/b4-3+,6-5+ |
| InChIKey | SFUOGWMMHCFCBL-VNKDHWASSA-N |
| XLogP | 2.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|