C10H14N2O4 — CID 107433897
2-[(2-amino-2-oxoethyl)-hexa-2,4-dienoylamino]acetic acid (PubChem CID 107433897) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-hexa-2,4-dienoylamino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-hexa-2,4-dienoylamino]acetic acid |
|---|---|
| PubChem CID | 107433897 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-hexa-2,4-dienoylamino]acetic acid |
| SMILES | CC=CC=CC(=O)N(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C10H14N2O4/c1-2-3-4-5-9(14)12(6-8(11)13)7-10(15)16/h2-5H,6-7H2,1H3,(H2,11,13)(H,15,16) |
| InChIKey | QATDPSJXZMFBPK-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|