C14H16F4 — CID 143939058
1,2-difluorobenzene;(1Z,3Z)-1,2-difluorohexa-1,3,5-triene;ethane (PubChem CID 143939058) has the molecular formula C14H16F4 and a molecular weight of 260.27 g/mol. Its IUPAC name is 1,2-difluorobenzene;(1Z,3Z)-1,2-difluorohexa-1,3,5-triene;ethane.
| Compound Name | 1,2-difluorobenzene;(1Z,3Z)-1,2-difluorohexa-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 143939058 |
| Molecular Formula | C14H16F4 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1,2-difluorobenzene;(1Z,3Z)-1,2-difluorohexa-1,3,5-triene;ethane |
| SMILES | C=C/C=C\C(F)=C\F.CC.Fc1ccccc1F |
| InChI | InChI=1S/C6H4F2.C6H6F2.C2H6/c7-5-3-1-2-4-6(5)8;1-2-3-4-6(8)5-7;1-2/h1-4H;2-5H,1H2;1-2H3/b;4-3-,6-5-; |
| InChIKey | QZKSOVAIFXFPJM-SAXVSKPSSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|