C19H17NO — CID 143629119
4-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)benzaldehyde (PubChem CID 143629119) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)benzaldehyde.
| Compound Name | 4-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)benzaldehyde |
|---|---|
| PubChem CID | 143629119 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-(N-[(3E)-hexa-1,3,5-trien-3-yl]anilino)benzaldehyde |
| SMILES | C=C/C=C(\C=C)N(c1ccccc1)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C19H17NO/c1-3-8-17(4-2)20(18-9-6-5-7-10-18)19-13-11-16(15-21)12-14-19/h3-15H,1-2H2/b17-8+ |
| InChIKey | FQBHISIVRYVICS-CAOOACKPSA-N |
| XLogP | 4.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|