C34H32N2O2 — CID 144980538
1-N,4-N-bis(3-ethenoxyphenyl)-1-N,4-N-bis[(3E)-hexa-1,3,5-trien-3-yl]benzene-1,4-diamine (PubChem CID 144980538) has the molecular formula C34H32N2O2 and a molecular weight of 500.64 g/mol. Its IUPAC name is 1-N,4-N-bis(3-ethenoxyphenyl)-1-N,4-N-bis[(3E)-hexa-1,3,5-trien-3-yl]benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(3-ethenoxyphenyl)-1-N,4-N-bis[(3E)-hexa-1,3,5-trien-3-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 144980538 |
| Molecular Formula | C34H32N2O2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 1-N,4-N-bis(3-ethenoxyphenyl)-1-N,4-N-bis[(3E)-hexa-1,3,5-trien-3-yl]benzene-1,4-diamine |
| SMILES | C=C/C=C(\C=C)N(c1ccc(N(/C(C=C)=C/C=C)c2cccc(OC=C)c2)cc1)c1cccc(OC=C)c1 |
| InChI | InChI=1S/C34H32N2O2/c1-7-15-27(9-3)35(31-17-13-19-33(25-31)37-11-5)29-21-23-30(24-22-29)36(28(10-4)16-8-2)32-18-14-20-34(26-32)38-12-6/h7-26H,1-6H2/b27-15+,28-16+ |
| InChIKey | ZPKPPRFEFJVQLC-DPCVLPDWSA-N |
| XLogP | 9.52 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|