C43H48N2O4 — CID 145306219
2-[3-[4-[3-(2-formyloxyethyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]anilino]-N-[(3E)-hexa-1,3,5-trien-3-yl]anilino]phenyl]ethyl 2-methylprop-2-enoate;2-methylprop-1-ene (PubChem CID 145306219) has the molecular formula C43H48N2O4 and a molecular weight of 656.87 g/mol. Its IUPAC name is 2-[3-[4-[3-(2-formyloxyethyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]anilino]-N-[(3E)-hexa-1,3,5-trien-3-yl]anilino]phenyl]ethyl 2-methylprop-2-enoate;2-methylprop-1-ene.
| Compound Name | 2-[3-[4-[3-(2-formyloxyethyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]anilino]-N-[(3E)-hexa-1,3,5-trien-3-yl]anilino]phenyl]ethyl 2-methylprop-2-enoate;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145306219 |
| Molecular Formula | C43H48N2O4 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.36 |
| IUPAC Name | 2-[3-[4-[3-(2-formyloxyethyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]anilino]-N-[(3E)-hexa-1,3,5-trien-3-yl]anilino]phenyl]ethyl 2-methylprop-2-enoate;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C/C=C(\C=C)N(c1ccc(N(/C(C=C)=C/C=C)c2cccc(CCOC(=O)C(=C)C)c2)cc1)c1cccc(CCOC=O)c1 |
| InChI | InChI=1S/C39H40N2O4.C4H8/c1-7-13-33(9-3)40(37-17-11-15-31(27-37)23-25-44-29-42)35-19-21-36(22-20-35)41(34(10-4)14-8-2)38-18-12-16-32(28-38)24-26-45-39(43)30(5)6;1-4(2)3/h7-22,27-29H,1-5,23-26H2,6H3;1H2,2-3H3/b33-13+,34-14+; |
| InChIKey | KWFBITZBISCXDF-ZUMGBZSBSA-N |
| XLogP | 10.43 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|