C49H48N2O4 — CID 143326279
2-[4-[N-(3-methylphenyl)-4-[(3E,5E)-6-[N-(3-methylphenyl)-4-(2-prop-2-enoyloxyethyl)anilino]hepta-1,3,5-trien-3-yl]anilino]phenyl]ethyl prop-2-enoate (PubChem CID 143326279) has the molecular formula C49H48N2O4 and a molecular weight of 728.93 g/mol. Its IUPAC name is 2-[4-[N-(3-methylphenyl)-4-[(3E,5E)-6-[N-(3-methylphenyl)-4-(2-prop-2-enoyloxyethyl)anilino]hepta-1,3,5-trien-3-yl]anilino]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[N-(3-methylphenyl)-4-[(3E,5E)-6-[N-(3-methylphenyl)-4-(2-prop-2-enoyloxyethyl)anilino]hepta-1,3,5-trien-3-yl]anilino]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 143326279 |
| Molecular Formula | C49H48N2O4 |
| Molecular Weight | 728.93 g/mol |
| Exact Mass | 728.36 |
| IUPAC Name | 2-[4-[N-(3-methylphenyl)-4-[(3E,5E)-6-[N-(3-methylphenyl)-4-(2-prop-2-enoyloxyethyl)anilino]hepta-1,3,5-trien-3-yl]anilino]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(N(/C(C)=C/C=C(\C=C)c2ccc(N(c3ccc(CCOC(=O)C=C)cc3)c3cccc(C)c3)cc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C49H48N2O4/c1-7-41(21-16-38(6)50(46-14-10-12-36(4)34-46)43-24-17-39(18-25-43)30-32-54-48(52)8-2)42-22-28-45(29-23-42)51(47-15-11-13-37(5)35-47)44-26-19-40(20-27-44)31-33-55-49(53)9-3/h7-29,34-35H,1-3,30-33H2,4-6H3/b38-16+,41-21+ |
| InChIKey | MICZTLQZVXSIIA-MELJQLOYSA-N |
| XLogP | 11.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.93 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|