About N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide
N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide (PubChem CID 134254475) has the molecular formula C17H21NO
and a molecular weight of 255.36 g/mol. Its IUPAC name is N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide.
Molecular Properties
| Compound Name | N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide |
| PubChem CID | 134254475 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide |
| SMILES | C=CC/C=C\C(=CCC)N(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C17H21NO/c1-4-6-8-12-16(11-5-2)18(15(3)19)17-13-9-7-10-14-17/h4,7-14H,1,5-6H2,2-3H3/b12-8-,16-11? |
| InChIKey | JNTOEYFCXRVXNB-TYAWLKMTSA-N |
| XLogP | 4.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide?
The IUPAC name of N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide (CID 134254475) is N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide.
What is the SMILES notation for N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide?
The canonical SMILES for N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide is C=CC/C=C\C(=CCC)N(C(C)=O)c1ccccc1.
What is the InChIKey of N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide?
The InChIKey is JNTOEYFCXRVXNB-TYAWLKMTSA-N. The full InChI is InChI=1S/C17H21NO/c1-4-6-8-12-16(11-5-2)18(15(3)19)17-13-9-7-10-14-17/h4,7-14H,1,5-6H2,2-3H3/b12-8-,16-11?.
What are the key properties of N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide?
N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide has a molecular weight of 255.36 g/mol, XLogP of 4.47, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5Z)-nona-3,5,8-trien-4-yl]-N-phenylacetamide is sourced from PubChem (CID 134254475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).