About N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline
N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline (PubChem CID 143909827) has the molecular formula C24H31N
and a molecular weight of 333.52 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline.
Molecular Properties
| Compound Name | N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline |
| PubChem CID | 143909827 |
| Molecular Formula | C24H31N |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline |
| SMILES | C/C=C(\C=C/CC)N(c1ccc(C)cc1)c1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C24H31N/c1-6-9-10-22(8-3)25(23-15-11-19(4)12-16-23)24-17-13-21(14-18-24)20(5)7-2/h8-18,20H,6-7H2,1-5H3/b10-9-,22-8+ |
| InChIKey | MBCLKQLKXGWFME-JCEYGHMBSA-N |
| XLogP | 7.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline?
The IUPAC name of N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline (CID 143909827) is N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline.
What is the SMILES notation for N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline?
The canonical SMILES for N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline is C/C=C(\C=C/CC)N(c1ccc(C)cc1)c1ccc(C(C)CC)cc1.
What is the InChIKey of N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline?
The InChIKey is MBCLKQLKXGWFME-JCEYGHMBSA-N. The full InChI is InChI=1S/C24H31N/c1-6-9-10-22(8-3)25(23-15-11-19(4)12-16-23)24-17-13-21(14-18-24)20(5)7-2/h8-18,20H,6-7H2,1-5H3/b10-9-,22-8+.
What are the key properties of N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline?
N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline has a molecular weight of 333.52 g/mol, XLogP of 7.52, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline is sourced from PubChem (CID 143909827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).