C24H31N — CID 143909827
N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline (PubChem CID 143909827) has the molecular formula C24H31N and a molecular weight of 333.52 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline.
| Compound Name | N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline |
|---|---|
| PubChem CID | 143909827 |
| Molecular Formula | C24H31N |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-N-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-methylaniline |
| SMILES | C/C=C(\C=C/CC)N(c1ccc(C)cc1)c1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C24H31N/c1-6-9-10-22(8-3)25(23-15-11-19(4)12-16-23)24-17-13-21(14-18-24)20(5)7-2/h8-18,20H,6-7H2,1-5H3/b10-9-,22-8+ |
| InChIKey | MBCLKQLKXGWFME-JCEYGHMBSA-N |
| XLogP | 7.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|