C16H22 — CID 142049182
1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene (PubChem CID 142049182) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene.
| Compound Name | 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 142049182 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene |
| SMILES | C/C=C(\C=C/CC)C(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22/c1-5-7-8-15(6-2)14(4)16-11-9-13(3)10-12-16/h6-12,14H,5H2,1-4H3/b8-7-,15-6+ |
| InChIKey | KJGNEWQPOZFUBG-SPJJUJCTSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|