About 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene
1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene (PubChem CID 142049182) has the molecular formula C16H22
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene |
| PubChem CID | 142049182 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene |
| SMILES | C/C=C(\C=C/CC)C(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22/c1-5-7-8-15(6-2)14(4)16-11-9-13(3)10-12-16/h6-12,14H,5H2,1-4H3/b8-7-,15-6+ |
| InChIKey | KJGNEWQPOZFUBG-SPJJUJCTSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene?
The IUPAC name of 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene (CID 142049182) is 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene.
What is the SMILES notation for 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene?
The canonical SMILES for 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene is C/C=C(\C=C/CC)C(C)c1ccc(C)cc1.
What is the InChIKey of 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene?
The InChIKey is KJGNEWQPOZFUBG-SPJJUJCTSA-N. The full InChI is InChI=1S/C16H22/c1-5-7-8-15(6-2)14(4)16-11-9-13(3)10-12-16/h6-12,14H,5H2,1-4H3/b8-7-,15-6+.
What are the key properties of 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene?
1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene has a molecular weight of 214.35 g/mol, XLogP of 5.01, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z,3E)-3-ethylidenehept-4-en-2-yl]-4-methylbenzene is sourced from PubChem (CID 142049182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).