C21H27N — CID 126723388
(1E,3Z)-2-[(4-methylcyclohexa-1,5-dien-1-yl)-(4-methylphenyl)methyl]hexa-1,3-dien-1-amine (PubChem CID 126723388) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is (1E,3Z)-2-[(4-methylcyclohexa-1,5-dien-1-yl)-(4-methylphenyl)methyl]hexa-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-2-[(4-methylcyclohexa-1,5-dien-1-yl)-(4-methylphenyl)methyl]hexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 126723388 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (1E,3Z)-2-[(4-methylcyclohexa-1,5-dien-1-yl)-(4-methylphenyl)methyl]hexa-1,3-dien-1-amine |
| SMILES | CC/C=C\C(=C/N)C(C1=CCC(C)C=C1)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H27N/c1-4-5-6-20(15-22)21(18-11-7-16(2)8-12-18)19-13-9-17(3)10-14-19/h5-9,11-15,17,21H,4,10,22H2,1-3H3/b6-5-,20-15+ |
| InChIKey | FHMJEIQJHWNWCN-XOGMPFMPSA-N |
| XLogP | 5.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|