C14H19P — CID 142967584
[(2E,4Z)-hepta-2,4-dien-3-yl]-(4-methylphenyl)phosphane (PubChem CID 142967584) has the molecular formula C14H19P and a molecular weight of 218.28 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4-dien-3-yl]-(4-methylphenyl)phosphane.
| Compound Name | [(2E,4Z)-hepta-2,4-dien-3-yl]-(4-methylphenyl)phosphane |
|---|---|
| PubChem CID | 142967584 |
| Molecular Formula | C14H19P |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [(2E,4Z)-hepta-2,4-dien-3-yl]-(4-methylphenyl)phosphane |
| SMILES | C/C=C(\C=C/CC)Pc1ccc(C)cc1 |
| InChI | InChI=1S/C14H19P/c1-4-6-7-13(5-2)15-14-10-8-12(3)9-11-14/h5-11,15H,4H2,1-3H3/b7-6-,13-5+ |
| InChIKey | HYHOSZMFCQVTPV-ZQNRWWJISA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|