C39H38N2 — CID 89028101
4-[(3E,5E)-6-(N-methylanilino)hepta-1,3,5-trien-3-yl]-N-phenyl-N-[(3E,5Z)-7-phenylhepta-1,3,5-trien-4-yl]aniline (PubChem CID 89028101) has the molecular formula C39H38N2 and a molecular weight of 534.75 g/mol. Its IUPAC name is 4-[(3E,5E)-6-(N-methylanilino)hepta-1,3,5-trien-3-yl]-N-phenyl-N-[(3E,5Z)-7-phenylhepta-1,3,5-trien-4-yl]aniline.
| Compound Name | 4-[(3E,5E)-6-(N-methylanilino)hepta-1,3,5-trien-3-yl]-N-phenyl-N-[(3E,5Z)-7-phenylhepta-1,3,5-trien-4-yl]aniline |
|---|---|
| PubChem CID | 89028101 |
| Molecular Formula | C39H38N2 |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 4-[(3E,5E)-6-(N-methylanilino)hepta-1,3,5-trien-3-yl]-N-phenyl-N-[(3E,5Z)-7-phenylhepta-1,3,5-trien-4-yl]aniline |
| SMILES | C=C/C=C(\C=C/Cc1ccccc1)N(c1ccccc1)c1ccc(/C(C=C)=C/C=C(\C)N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H38N2/c1-5-17-37(25-16-20-33-18-10-7-11-19-33)41(38-23-14-9-15-24-38)39-30-28-35(29-31-39)34(6-2)27-26-32(3)40(4)36-21-12-8-13-22-36/h5-19,21-31H,1-2,20H2,3-4H3/b25-16-,32-26+,34-27+,37-17+ |
| InChIKey | MXYDKSIFWXMKCB-GMACRTBQSA-N |
| XLogP | 10.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|