C48H66N2 — CID 143498674
N-[(3E,5Z)-8-ethyldeca-1,3,5-trien-4-yl]-4-[(2E,4Z)-6-[[(2E,4Z)-7-ethylnona-2,4-dien-3-yl]-[(2Z,4Z)-hepta-2,4-dienyl]amino]hexa-2,4-dien-3-yl]-N-phenylaniline (PubChem CID 143498674) has the molecular formula C48H66N2 and a molecular weight of 671.07 g/mol. Its IUPAC name is N-[(3E,5Z)-8-ethyldeca-1,3,5-trien-4-yl]-4-[(2E,4Z)-6-[[(2E,4Z)-7-ethylnona-2,4-dien-3-yl]-[(2Z,4Z)-hepta-2,4-dienyl]amino]hexa-2,4-dien-3-yl]-N-phenylaniline.
| Compound Name | N-[(3E,5Z)-8-ethyldeca-1,3,5-trien-4-yl]-4-[(2E,4Z)-6-[[(2E,4Z)-7-ethylnona-2,4-dien-3-yl]-[(2Z,4Z)-hepta-2,4-dienyl]amino]hexa-2,4-dien-3-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 143498674 |
| Molecular Formula | C48H66N2 |
| Molecular Weight | 671.07 g/mol |
| Exact Mass | 670.52 |
| IUPAC Name | N-[(3E,5Z)-8-ethyldeca-1,3,5-trien-4-yl]-4-[(2E,4Z)-6-[[(2E,4Z)-7-ethylnona-2,4-dien-3-yl]-[(2Z,4Z)-hepta-2,4-dienyl]amino]hexa-2,4-dien-3-yl]-N-phenylaniline |
| SMILES | C=C/C=C(\C=C/CC(CC)CC)N(c1ccccc1)c1ccc(C(/C=C\CN(C/C=C\C=C/CC)C(/C=C\CC(CC)CC)=C/C)=C/C)cc1 |
| InChI | InChI=1S/C48H66N2/c1-9-17-18-19-23-39-49(45(16-8)33-24-28-41(11-3)12-4)40-26-30-43(15-7)44-35-37-48(38-36-44)50(47-31-21-20-22-32-47)46(27-10-2)34-25-29-42(13-5)14-6/h10,15-27,30-38,41-42H,2,9,11-14,28-29,39-40H2,1,3-8H3/b18-17-,23-19-,30-26-,33-24-,34-25-,43-15+,45-16+,46-27+ |
| InChIKey | ZVZLVSOWMXZDAN-DKJVRBFFSA-N |
| XLogP | 14.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.07 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|