C37H31N — CID 89078708
4-phenyl-N-[(2Z,4E)-4-phenylhepta-2,4,6-trienyl]-N-(4-phenylphenyl)aniline (PubChem CID 89078708) has the molecular formula C37H31N and a molecular weight of 489.66 g/mol. Its IUPAC name is 4-phenyl-N-[(2Z,4E)-4-phenylhepta-2,4,6-trienyl]-N-(4-phenylphenyl)aniline.
| Compound Name | 4-phenyl-N-[(2Z,4E)-4-phenylhepta-2,4,6-trienyl]-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 89078708 |
| Molecular Formula | C37H31N |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 4-phenyl-N-[(2Z,4E)-4-phenylhepta-2,4,6-trienyl]-N-(4-phenylphenyl)aniline |
| SMILES | C=C/C=C(\C=C/CN(c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C37H31N/c1-2-13-30(31-14-6-3-7-15-31)20-12-29-38(36-25-21-34(22-26-36)32-16-8-4-9-17-32)37-27-23-35(24-28-37)33-18-10-5-11-19-33/h2-28H,1,29H2/b20-12-,30-13+ |
| InChIKey | ZLOOHLPUFYHZRP-NUQIMWQUSA-N |
| XLogP | 9.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|