C21H23N — CID 88770312
(2E,4E)-N-methyl-4,5-diphenyl-N-prop-2-enylpenta-2,4-dien-1-amine (PubChem CID 88770312) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is (2E,4E)-N-methyl-4,5-diphenyl-N-prop-2-enylpenta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-N-methyl-4,5-diphenyl-N-prop-2-enylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 88770312 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (2E,4E)-N-methyl-4,5-diphenyl-N-prop-2-enylpenta-2,4-dien-1-amine |
| SMILES | C=CCN(C)C/C=C/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23N/c1-3-16-22(2)17-10-15-21(20-13-8-5-9-14-20)18-19-11-6-4-7-12-19/h3-15,18H,1,16-17H2,2H3/b15-10+,21-18+ |
| InChIKey | KAGIPCGEFAAGEI-REFVHMSQSA-N |
| XLogP | 4.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|