C27H22N2 — CID 5357615
N-[[(E)-2,3-diphenylprop-2-enylidene]amino]-N-phenylaniline (PubChem CID 5357615) has the molecular formula C27H22N2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[[(E)-2,3-diphenylprop-2-enylidene]amino]-N-phenylaniline.
| Compound Name | N-[[(E)-2,3-diphenylprop-2-enylidene]amino]-N-phenylaniline |
|---|---|
| PubChem CID | 5357615 |
| Molecular Formula | C27H22N2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[[(E)-2,3-diphenylprop-2-enylidene]amino]-N-phenylaniline |
| SMILES | C(=NN(c1ccccc1)c1ccccc1)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22N2/c1-5-13-23(14-6-1)21-25(24-15-7-2-8-16-24)22-28-29(26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-22H/b25-21-,28-22? |
| InChIKey | UJUUAFMHDJNYSS-FEUNWOAKSA-N |
| XLogP | 7.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|